About (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine
(E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine (PubChem CID 163252486) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine.
Analyze (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine?
The IUPAC name of (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine (CID 163252486) is (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine.
What is the SMILES notation for (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine?
The canonical SMILES for (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine is CC/C(=C\NC)N(C)CC.
What is the InChIKey of (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine?
The InChIKey is RHCGGLXEJMREAE-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H18N2/c1-5-8(7-9-3)10(4)6-2/h7,9H,5-6H2,1-4H3/b8-7+.
What are the key properties of (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine?
(E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine has a molecular weight of 142.25 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-N-ethyl-1-N,2-N-dimethylbut-1-ene-1,2-diamine is sourced from PubChem (CID 163252486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).