C9H17NO — CID 172631579
(Z)-N,2-diethyl-N-methylbut-2-enamide (PubChem CID 172631579) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-N,2-diethyl-N-methylbut-2-enamide.
| Compound Name | (Z)-N,2-diethyl-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 172631579 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z)-N,2-diethyl-N-methylbut-2-enamide |
| SMILES | C/C=C(/CC)C(=O)N(C)CC |
| InChI | InChI=1S/C9H17NO/c1-5-8(6-2)9(11)10(4)7-3/h5H,6-7H2,1-4H3/b8-5- |
| InChIKey | UGXVHZGLKWEREQ-YVMONPNESA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|