About 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine
2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine (PubChem CID 19887909) has the molecular formula C7H16N2O3
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine |
| PubChem CID | 19887909 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine |
| SMILES | CCN(C)C(=O)C(=O)O.CNC |
| InChI | InChI=1S/C5H9NO3.C2H7N/c1-3-6(2)4(7)5(8)9;1-3-2/h3H2,1-2H3,(H,8,9);3H,1-2H3 |
| InChIKey | JCSPPPGQORDBPU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine?
The IUPAC name of 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine (CID 19887909) is 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine.
What is the SMILES notation for 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine?
The canonical SMILES for 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine is CCN(C)C(=O)C(=O)O.CNC.
What is the InChIKey of 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine?
The InChIKey is JCSPPPGQORDBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3.C2H7N/c1-3-6(2)4(7)5(8)9;1-3-2/h3H2,1-2H3,(H,8,9);3H,1-2H3.
What are the key properties of 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine?
2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine has a molecular weight of 176.22 g/mol, XLogP of -0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(methyl)amino]-2-oxoacetic acid;N-methylmethanamine is sourced from PubChem (CID 19887909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).