C15H20NRu — CID 59758256
N-[(4-ethylbenzene-5-id-1-yl)methyl]-N-prop-1-en-2-ylprop-1-en-2-amine;ruthenium(1+) (PubChem CID 59758256) has the molecular formula C15H20NRu and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[(4-ethylbenzene-5-id-1-yl)methyl]-N-prop-1-en-2-ylprop-1-en-2-amine;ruthenium(1+).
| Compound Name | N-[(4-ethylbenzene-5-id-1-yl)methyl]-N-prop-1-en-2-ylprop-1-en-2-amine;ruthenium(1+) |
|---|---|
| PubChem CID | 59758256 |
| Molecular Formula | C15H20NRu |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-[(4-ethylbenzene-5-id-1-yl)methyl]-N-prop-1-en-2-ylprop-1-en-2-amine;ruthenium(1+) |
| SMILES | C=C(C)N(Cc1c[c-]c(CC)cc1)C(=C)C.[Ru+] |
| InChI | InChI=1S/C15H20N.Ru/c1-6-14-7-9-15(10-8-14)11-16(12(2)3)13(4)5;/h7,9-10H,2,4,6,11H2,1,3,5H3;/q-1;+1 |
| InChIKey | KMQMDVZSQMDHKZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|