C18H31N — CID 88927966
(2E)-3,7-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propylocta-2,6-dien-1-amine (PubChem CID 88927966) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propylocta-2,6-dien-1-amine.
| Compound Name | (2E)-3,7-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 88927966 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (2E)-3,7-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propylocta-2,6-dien-1-amine |
| SMILES | C=C(/C=C/C)N(C/C=C(\C)CCC=C(C)C)CCC |
| InChI | InChI=1S/C18H31N/c1-7-10-18(6)19(14-8-2)15-13-17(5)12-9-11-16(3)4/h7,10-11,13H,6,8-9,12,14-15H2,1-5H3/b10-7+,17-13+ |
| InChIKey | MOQBDCNIQCLUEL-UVZCHINQSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|