C15H22FN — CID 138564061
(3Z,5Z)-N-ethenyl-3-fluoro-N,5-dimethyl-8-methylidenedeca-3,5,9-trien-4-amine (PubChem CID 138564061) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is (3Z,5Z)-N-ethenyl-3-fluoro-N,5-dimethyl-8-methylidenedeca-3,5,9-trien-4-amine.
| Compound Name | (3Z,5Z)-N-ethenyl-3-fluoro-N,5-dimethyl-8-methylidenedeca-3,5,9-trien-4-amine |
|---|---|
| PubChem CID | 138564061 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (3Z,5Z)-N-ethenyl-3-fluoro-N,5-dimethyl-8-methylidenedeca-3,5,9-trien-4-amine |
| SMILES | C=CC(=C)C/C=C(C)\C(=C(\F)CC)N(C)C=C |
| InChI | InChI=1S/C15H22FN/c1-7-12(4)10-11-13(5)15(14(16)8-2)17(6)9-3/h7,9,11H,1,3-4,8,10H2,2,5-6H3/b13-11-,15-14- |
| InChIKey | DZJAPXGGTOBYOB-WABAVOORSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|