C14H22F3N — CID 123265710
N,N,3-trimethyl-6-(trifluoromethyl)deca-2,4,6-trien-4-amine (PubChem CID 123265710) has the molecular formula C14H22F3N and a molecular weight of 261.33 g/mol. Its IUPAC name is N,N,3-trimethyl-6-(trifluoromethyl)deca-2,4,6-trien-4-amine.
| Compound Name | N,N,3-trimethyl-6-(trifluoromethyl)deca-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 123265710 |
| Molecular Formula | C14H22F3N |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N,N,3-trimethyl-6-(trifluoromethyl)deca-2,4,6-trien-4-amine |
| SMILES | CC=C(C)C(=CC(=CCCC)C(F)(F)F)N(C)C |
| InChI | InChI=1S/C14H22F3N/c1-6-8-9-12(14(15,16)17)10-13(18(4)5)11(3)7-2/h7,9-10H,6,8H2,1-5H3 |
| InChIKey | AWLSYBDCDZFIPI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|