C8H12F3N — CID 129041662
(2Z)-N,N-dimethyl-4-(trifluoromethyl)penta-2,4-dien-2-amine (PubChem CID 129041662) has the molecular formula C8H12F3N and a molecular weight of 179.18 g/mol. Its IUPAC name is (2Z)-N,N-dimethyl-4-(trifluoromethyl)penta-2,4-dien-2-amine.
| Compound Name | (2Z)-N,N-dimethyl-4-(trifluoromethyl)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 129041662 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2Z)-N,N-dimethyl-4-(trifluoromethyl)penta-2,4-dien-2-amine |
| SMILES | C=C(/C=C(/C)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N/c1-6(8(9,10)11)5-7(2)12(3)4/h5H,1H2,2-4H3/b7-5- |
| InChIKey | JOAWZAQTJVLFJQ-ALCCZGGFSA-N |
| XLogP | 2.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|