C10H15F3N+ — CID 123139499
2-ethyl-1,1,5-trimethyl-3-(trifluoromethyl)pyrrol-1-ium (PubChem CID 123139499) has the molecular formula C10H15F3N+ and a molecular weight of 206.23 g/mol. Its IUPAC name is 2-ethyl-1,1,5-trimethyl-3-(trifluoromethyl)pyrrol-1-ium.
| Compound Name | 2-ethyl-1,1,5-trimethyl-3-(trifluoromethyl)pyrrol-1-ium |
|---|---|
| PubChem CID | 123139499 |
| Molecular Formula | C10H15F3N+ |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-ethyl-1,1,5-trimethyl-3-(trifluoromethyl)pyrrol-1-ium |
| SMILES | CCC1=C(C(F)(F)F)C=C(C)[N+]1(C)C |
| InChI | InChI=1S/C10H15F3N/c1-5-9-8(10(11,12)13)6-7(2)14(9,3)4/h6H,5H2,1-4H3/q+1 |
| InChIKey | IEYICRRQDDGUDP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|