C17H28FN — CID 135266370
(2E)-1-fluoro-7-methyl-4,5-dimethylidene-N,N-dipropylocta-2,7-dien-2-amine (PubChem CID 135266370) has the molecular formula C17H28FN and a molecular weight of 265.42 g/mol. Its IUPAC name is (2E)-1-fluoro-7-methyl-4,5-dimethylidene-N,N-dipropylocta-2,7-dien-2-amine.
| Compound Name | (2E)-1-fluoro-7-methyl-4,5-dimethylidene-N,N-dipropylocta-2,7-dien-2-amine |
|---|---|
| PubChem CID | 135266370 |
| Molecular Formula | C17H28FN |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (2E)-1-fluoro-7-methyl-4,5-dimethylidene-N,N-dipropylocta-2,7-dien-2-amine |
| SMILES | C=C(C)CC(=C)C(=C)/C=C(\CF)N(CCC)CCC |
| InChI | InChI=1S/C17H28FN/c1-7-9-19(10-8-2)17(13-18)12-16(6)15(5)11-14(3)4/h12H,3,5-11,13H2,1-2,4H3/b17-12+ |
| InChIKey | VATNWLSQZRQOMZ-SFQUDFHCSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|