C16H24FN — CID 143750069
(3E,5Z,8Z)-4-fluoro-1,9-dimethyl-7-methylidene-8-pentyl-2H-azonine (PubChem CID 143750069) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is (3E,5Z,8Z)-4-fluoro-1,9-dimethyl-7-methylidene-8-pentyl-2H-azonine.
| Compound Name | (3E,5Z,8Z)-4-fluoro-1,9-dimethyl-7-methylidene-8-pentyl-2H-azonine |
|---|---|
| PubChem CID | 143750069 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (3E,5Z,8Z)-4-fluoro-1,9-dimethyl-7-methylidene-8-pentyl-2H-azonine |
| SMILES | C=C1/C=C\C(F)=C/CN(C)/C(C)=C\1CCCCC |
| InChI | InChI=1S/C16H24FN/c1-5-6-7-8-16-13(2)9-10-15(17)11-12-18(4)14(16)3/h9-11H,2,5-8,12H2,1,3-4H3/b10-9-,15-11+,16-14- |
| InChIKey | RVWAJJIFVNTATI-XBJJAIEVSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|