C15H26FN — CID 143750184
(2Z,5E,7Z)-3-butyl-5-fluoro-N,N-dimethylnona-2,5,7-trien-2-amine (PubChem CID 143750184) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is (2Z,5E,7Z)-3-butyl-5-fluoro-N,N-dimethylnona-2,5,7-trien-2-amine.
| Compound Name | (2Z,5E,7Z)-3-butyl-5-fluoro-N,N-dimethylnona-2,5,7-trien-2-amine |
|---|---|
| PubChem CID | 143750184 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (2Z,5E,7Z)-3-butyl-5-fluoro-N,N-dimethylnona-2,5,7-trien-2-amine |
| SMILES | C/C=C\C=C(\F)C/C(CCCC)=C(/C)N(C)C |
| InChI | InChI=1S/C15H26FN/c1-6-8-10-14(13(3)17(4)5)12-15(16)11-9-7-2/h7,9,11H,6,8,10,12H2,1-5H3/b9-7-,14-13-,15-11+ |
| InChIKey | OXKWLJARWPXRTP-AQJKYTKMSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|