C14H17F2N — CID 167018857
3-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]-1-ethyl-2,5-dimethyl-4-methylidenepyridine (PubChem CID 167018857) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is 3-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]-1-ethyl-2,5-dimethyl-4-methylidenepyridine.
| Compound Name | 3-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]-1-ethyl-2,5-dimethyl-4-methylidenepyridine |
|---|---|
| PubChem CID | 167018857 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[(1E,3E)-2,4-difluorobuta-1,3-dienyl]-1-ethyl-2,5-dimethyl-4-methylidenepyridine |
| SMILES | C=C1C(C)=CN(CC)C(C)=C1/C=C(F)\C=C\F |
| InChI | InChI=1S/C14H17F2N/c1-5-17-9-10(2)11(3)14(12(17)4)8-13(16)6-7-15/h6-9H,3,5H2,1-2,4H3/b7-6+,13-8+ |
| InChIKey | VJZLLYWDVUUFCP-GTTXMNNRSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|