C8H11F2N — CID 130252923
1-(2,2-difluoroethyl)-5-methyl-2H-pyridine (PubChem CID 130252923) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-methyl-2H-pyridine.
| Compound Name | 1-(2,2-difluoroethyl)-5-methyl-2H-pyridine |
|---|---|
| PubChem CID | 130252923 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-methyl-2H-pyridine |
| SMILES | CC1=CN(CC(F)F)CC=C1 |
| InChI | InChI=1S/C8H11F2N/c1-7-3-2-4-11(5-7)6-8(9)10/h2-3,5,8H,4,6H2,1H3 |
| InChIKey | MEJNMARJEBYADP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |