C9H13F3N+ — CID 123991187
1,1,3-trimethyl-5-(trifluoromethyl)-2H-pyridin-1-ium (PubChem CID 123991187) has the molecular formula C9H13F3N+ and a molecular weight of 192.20 g/mol. Its IUPAC name is 1,1,3-trimethyl-5-(trifluoromethyl)-2H-pyridin-1-ium.
| Compound Name | 1,1,3-trimethyl-5-(trifluoromethyl)-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 123991187 |
| Molecular Formula | C9H13F3N+ |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1,1,3-trimethyl-5-(trifluoromethyl)-2H-pyridin-1-ium |
| SMILES | CC1=CC(C(F)(F)F)=C[N+](C)(C)C1 |
| InChI | InChI=1S/C9H13F3N/c1-7-4-8(9(10,11)12)6-13(2,3)5-7/h4,6H,5H2,1-3H3/q+1 |
| InChIKey | KVESBNZAXSWGJQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|