C17H24FN — CID 143968698
(3Z,5E,8Z)-1-tert-butyl-5-fluoro-9-[(1E)-3-methylbuta-1,3-dienyl]-2,7-dihydroazonine (PubChem CID 143968698) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is (3Z,5E,8Z)-1-tert-butyl-5-fluoro-9-[(1E)-3-methylbuta-1,3-dienyl]-2,7-dihydroazonine.
| Compound Name | (3Z,5E,8Z)-1-tert-butyl-5-fluoro-9-[(1E)-3-methylbuta-1,3-dienyl]-2,7-dihydroazonine |
|---|---|
| PubChem CID | 143968698 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | (3Z,5E,8Z)-1-tert-butyl-5-fluoro-9-[(1E)-3-methylbuta-1,3-dienyl]-2,7-dihydroazonine |
| SMILES | C=C(C)/C=C/C1=C/C/C=C(F)\C=C/CN1C(C)(C)C |
| InChI | InChI=1S/C17H24FN/c1-14(2)11-12-16-10-6-8-15(18)9-7-13-19(16)17(3,4)5/h7-12H,1,6,13H2,2-5H3/b9-7-,12-11+,15-8+,16-10- |
| InChIKey | KPIGWZDXJLJBDI-AKKOHYGQSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|