C14H25F2N — CID 144717287
(3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine;ethane (PubChem CID 144717287) has the molecular formula C14H25F2N and a molecular weight of 245.36 g/mol. Its IUPAC name is (3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine;ethane.
| Compound Name | (3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine;ethane |
|---|---|
| PubChem CID | 144717287 |
| Molecular Formula | C14H25F2N |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | (3Z)-N-(2,2-difluorobutyl)-N,5-dimethylhexa-1,3,5-trien-2-amine;ethane |
| SMILES | C=C(C)/C=C\C(=C)N(C)CC(F)(F)CC.CC |
| InChI | InChI=1S/C12H19F2N.C2H6/c1-6-12(13,14)9-15(5)11(4)8-7-10(2)3;1-2/h7-8H,2,4,6,9H2,1,3,5H3;1-2H3/b8-7-; |
| InChIKey | GPVZPZHPAQHZSE-CFYXSCKTSA-N |
| XLogP | 4.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|