About ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine
ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 144539787) has the molecular formula C14H26F3N
and a molecular weight of 265.36 g/mol. Its IUPAC name is ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 144539787 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | CC.CC.CCN(C)C1=CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3N.2C2H6/c1-3-14(2)9-6-4-8(5-7-9)10(11,12)13;2*1-2/h4,6H,3,5,7H2,1-2H3;2*1-2H3 |
| InChIKey | PHWYEUQIGBILNY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (CID 144539787) is ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is CC.CC.CCN(C)C1=CC=C(C(F)(F)F)CC1.
What is the InChIKey of ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is PHWYEUQIGBILNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N.2C2H6/c1-3-14(2)9-6-4-8(5-7-9)10(11,12)13;2*1-2/h4,6H,3,5,7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 265.36 g/mol, XLogP of 5.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N-methyl-4-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 144539787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).