C9H15N — CID 19835393
N,N,4-trimethylcyclohexa-1,3-dien-1-amine (PubChem CID 19835393) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N,N,4-trimethylcyclohexa-1,3-dien-1-amine.
| Compound Name | N,N,4-trimethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 19835393 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N,N,4-trimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1=CC=C(N(C)C)CC1 |
| InChI | InChI=1S/C9H15N/c1-8-4-6-9(7-5-8)10(2)3/h4,6H,5,7H2,1-3H3 |
| InChIKey | RXFLESCYAYTYFR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |