C13H21N — CID 20701235
1-methyl-6-methylidene-2,3-di(propan-2-yl)pyridine (PubChem CID 20701235) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-methyl-6-methylidene-2,3-di(propan-2-yl)pyridine.
| Compound Name | 1-methyl-6-methylidene-2,3-di(propan-2-yl)pyridine |
|---|---|
| PubChem CID | 20701235 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 1-methyl-6-methylidene-2,3-di(propan-2-yl)pyridine |
| SMILES | C=C1C=CC(C(C)C)=C(C(C)C)N1C |
| InChI | InChI=1S/C13H21N/c1-9(2)12-8-7-11(5)14(6)13(12)10(3)4/h7-10H,5H2,1-4,6H3 |
| InChIKey | JSHYNOOVEYTKHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |