C14H20 — CID 176659804
2-[(3Z)-hepta-1,3-dien-4-yl]-3-methylcyclohexa-1,3-diene (PubChem CID 176659804) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-[(3Z)-hepta-1,3-dien-4-yl]-3-methylcyclohexa-1,3-diene.
| Compound Name | 2-[(3Z)-hepta-1,3-dien-4-yl]-3-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 176659804 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-[(3Z)-hepta-1,3-dien-4-yl]-3-methylcyclohexa-1,3-diene |
| SMILES | C=C/C=C(/CCC)C1=CCCC=C1C |
| InChI | InChI=1S/C14H20/c1-4-8-13(9-5-2)14-11-7-6-10-12(14)3/h4,8,10-11H,1,5-7,9H2,2-3H3/b13-8- |
| InChIKey | LRIHBUJVVVEMBA-JYRVWZFOSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|