C25H32 — CID 144940199
6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-3,7-dimethyl-4-pent-1-en-2-yl-1,6,7,8-tetrahydroazulene (PubChem CID 144940199) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-3,7-dimethyl-4-pent-1-en-2-yl-1,6,7,8-tetrahydroazulene.
| Compound Name | 6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-3,7-dimethyl-4-pent-1-en-2-yl-1,6,7,8-tetrahydroazulene |
|---|---|
| PubChem CID | 144940199 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 6-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-3,7-dimethyl-4-pent-1-en-2-yl-1,6,7,8-tetrahydroazulene |
| SMILES | C=C/C=C(C=C)/C=C/C1C=C(C(=C)CCC)C2=C(CC=C2C)CC1C |
| InChI | InChI=1S/C25H32/c1-7-10-18(4)24-17-22(15-13-21(9-3)11-8-2)20(6)16-23-14-12-19(5)25(23)24/h8-9,11-13,15,17,20,22H,2-4,7,10,14,16H2,1,5-6H3/b15-13+,21-11+ |
| InChIKey | WEYOTKFOWUKSIW-BKQJDDMZSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|