C12H17N — CID 123172598
6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine (PubChem CID 123172598) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine.
| Compound Name | 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123172598 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine |
| SMILES | C=CC(=C)CCC1C=C(C)N=CC1 |
| InChI | InChI=1S/C12H17N/c1-4-10(2)5-6-12-7-8-13-11(3)9-12/h4,8-9,12H,1-2,5-7H2,3H3 |
| InChIKey | OFOSXQMFOSWLNZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|