About 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine
6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine (PubChem CID 123172598) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine |
| PubChem CID | 123172598 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine |
| SMILES | C=CC(=C)CCC1C=C(C)N=CC1 |
| InChI | InChI=1S/C12H17N/c1-4-10(2)5-6-12-7-8-13-11(3)9-12/h4,8-9,12H,1-2,5-7H2,3H3 |
| InChIKey | OFOSXQMFOSWLNZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine?
The IUPAC name of 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine (CID 123172598) is 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine.
What is the SMILES notation for 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine?
The canonical SMILES for 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine is C=CC(=C)CCC1C=C(C)N=CC1.
What is the InChIKey of 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine?
The InChIKey is OFOSXQMFOSWLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-10(2)5-6-12-7-8-13-11(3)9-12/h4,8-9,12H,1-2,5-7H2,3H3.
What are the key properties of 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine?
6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine has a molecular weight of 175.27 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-(3-methylidenepent-4-enyl)-3,4-dihydropyridine is sourced from PubChem (CID 123172598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).