C15H24 — CID 143644064
2-methyl-3-[(E)-oct-3-en-3-yl]cyclohexa-1,3-diene (PubChem CID 143644064) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-methyl-3-[(E)-oct-3-en-3-yl]cyclohexa-1,3-diene.
| Compound Name | 2-methyl-3-[(E)-oct-3-en-3-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143644064 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 2-methyl-3-[(E)-oct-3-en-3-yl]cyclohexa-1,3-diene |
| SMILES | CCCC/C=C(\CC)C1=CCCC=C1C |
| InChI | InChI=1S/C15H24/c1-4-6-7-11-14(5-2)15-12-9-8-10-13(15)3/h10-12H,4-9H2,1-3H3/b14-11+ |
| InChIKey | KHUNYHIRUZVZHK-SDNWHVSQSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|