C35H47Cl — CID 144557532
1-(3-chloroprop-1-en-2-yl)-4-[(3Z)-3-(6-methylcyclohexa-1,5-dien-1-yl)octa-1,3-dien-2-yl]naphthalene;heptane (PubChem CID 144557532) has the molecular formula C35H47Cl and a molecular weight of 503.21 g/mol. Its IUPAC name is 1-(3-chloroprop-1-en-2-yl)-4-[(3Z)-3-(6-methylcyclohexa-1,5-dien-1-yl)octa-1,3-dien-2-yl]naphthalene;heptane.
| Compound Name | 1-(3-chloroprop-1-en-2-yl)-4-[(3Z)-3-(6-methylcyclohexa-1,5-dien-1-yl)octa-1,3-dien-2-yl]naphthalene;heptane |
|---|---|
| PubChem CID | 144557532 |
| Molecular Formula | C35H47Cl |
| Molecular Weight | 503.21 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 1-(3-chloroprop-1-en-2-yl)-4-[(3Z)-3-(6-methylcyclohexa-1,5-dien-1-yl)octa-1,3-dien-2-yl]naphthalene;heptane |
| SMILES | C=C(CCl)c1ccc(C(=C)/C(=C/CCCC)C2=CCCC=C2C)c2ccccc12.CCCCCCC |
| InChI | InChI=1S/C28H31Cl.C7H16/c1-5-6-7-14-25(23-13-9-8-12-20(23)2)22(4)26-18-17-24(21(3)19-29)27-15-10-11-16-28(26)27;1-3-5-7-6-4-2/h10-18H,3-9,19H2,1-2H3;3-7H2,1-2H3/b25-14-; |
| InChIKey | NGHHGCQTLISLAE-DNFJTNLYSA-N |
| XLogP | 11.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.21 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|