C24H44 — CID 163402513
1,4-bis[(E)-hept-2-en-2-yl]cyclohexa-1,3-diene;ethane (PubChem CID 163402513) has the molecular formula C24H44 and a molecular weight of 332.62 g/mol. Its IUPAC name is 1,4-bis[(E)-hept-2-en-2-yl]cyclohexa-1,3-diene;ethane.
| Compound Name | 1,4-bis[(E)-hept-2-en-2-yl]cyclohexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 163402513 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | 1,4-bis[(E)-hept-2-en-2-yl]cyclohexa-1,3-diene;ethane |
| SMILES | CC.CC.CCCC/C=C(\C)C1=CC=C(/C(C)=C/CCCC)CC1 |
| InChI | InChI=1S/C20H32.2C2H6/c1-5-7-9-11-17(3)19-13-15-20(16-14-19)18(4)12-10-8-6-2;2*1-2/h11-13,15H,5-10,14,16H2,1-4H3;2*1-2H3/b17-11+,18-12+;; |
| InChIKey | MFHFLBRGVYXLCW-SNTCFBDDSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|