C14H13B — CID 163262165
CID 163262165 (PubChem CID 163262165) has the molecular formula C14H13B and a molecular weight of 192.07 g/mol.
| Compound Name | CID 163262165 |
|---|---|
| PubChem CID | 163262165 |
| Molecular Formula | C14H13B |
| Molecular Weight | 192.07 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=C)C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C14H13B/c1-11(12-5-3-2-4-6-12)13-7-9-14(15)10-8-13/h2-3,5,7-10H,1,4,6H2 |
| InChIKey | KRODCUDQICFXFV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|