C19H22 — CID 143759676
1-[(2E,4E)-5-cyclohexa-1,3-dien-1-ylhexa-2,4-dien-2-yl]-4-methylbenzene (PubChem CID 143759676) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-[(2E,4E)-5-cyclohexa-1,3-dien-1-ylhexa-2,4-dien-2-yl]-4-methylbenzene.
| Compound Name | 1-[(2E,4E)-5-cyclohexa-1,3-dien-1-ylhexa-2,4-dien-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 143759676 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[(2E,4E)-5-cyclohexa-1,3-dien-1-ylhexa-2,4-dien-2-yl]-4-methylbenzene |
| SMILES | C/C(=C\C=C(/C)c1ccc(C)cc1)C1=CC=CCC1 |
| InChI | InChI=1S/C19H22/c1-15-9-13-19(14-10-15)17(3)12-11-16(2)18-7-5-4-6-8-18/h4-5,7,9-14H,6,8H2,1-3H3/b16-11+,17-12+ |
| InChIKey | IOCKFRJTDHHQFO-MAEUFBSDSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|