C26H32 — CID 142925856
1-[(1Z,3E)-1-cyclohexa-1,3-dien-1-yl-3-methylhexa-1,3,5-trien-2-yl]-4-methylbenzene;(3Z)-2-methylpenta-1,3-diene (PubChem CID 142925856) has the molecular formula C26H32 and a molecular weight of 344.54 g/mol. Its IUPAC name is 1-[(1Z,3E)-1-cyclohexa-1,3-dien-1-yl-3-methylhexa-1,3,5-trien-2-yl]-4-methylbenzene;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | 1-[(1Z,3E)-1-cyclohexa-1,3-dien-1-yl-3-methylhexa-1,3,5-trien-2-yl]-4-methylbenzene;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 142925856 |
| Molecular Formula | C26H32 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1-[(1Z,3E)-1-cyclohexa-1,3-dien-1-yl-3-methylhexa-1,3,5-trien-2-yl]-4-methylbenzene;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C=C(C)/C=C\C.C=C/C=C(C)/C(=C/C1=CC=CCC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22.C6H10/c1-4-8-17(3)20(15-18-9-6-5-7-10-18)19-13-11-16(2)12-14-19;1-4-5-6(2)3/h4-6,8-9,11-15H,1,7,10H2,2-3H3;4-5H,2H2,1,3H3/b17-8+,20-15-;5-4- |
| InChIKey | WDHFKGIZOOKPIH-GYCDHAGPSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|