C25H33N — CID 142469835
methanamine;1-methyl-4-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]benzene;toluene (PubChem CID 142469835) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is methanamine;1-methyl-4-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]benzene;toluene.
| Compound Name | methanamine;1-methyl-4-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]benzene;toluene |
|---|---|
| PubChem CID | 142469835 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | methanamine;1-methyl-4-[(2E,4Z,7Z)-6-methylidenenona-2,4,7-trien-2-yl]benzene;toluene |
| SMILES | C=C(/C=C\C)/C=C\C=C(/C)c1ccc(C)cc1.CN.Cc1ccccc1 |
| InChI | InChI=1S/C17H20.C7H8.CH5N/c1-5-7-14(2)8-6-9-16(4)17-12-10-15(3)11-13-17;1-7-5-3-2-4-6-7;1-2/h5-13H,2H2,1,3-4H3;2-6H,1H3;2H2,1H3/b7-5-,8-6-,16-9+;; |
| InChIKey | TTYFNTIBLBXKGG-KTMZVHIZSA-N |
| XLogP | 6.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|