C20H22O — CID 143744934
1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-(4-methylphenoxy)benzene (PubChem CID 143744934) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-(4-methylphenoxy)benzene.
| Compound Name | 1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-(4-methylphenoxy)benzene |
|---|---|
| PubChem CID | 143744934 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4-dien-2-yl]-4-(4-methylphenoxy)benzene |
| SMILES | CC/C=C\C=C(/C)c1ccc(Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H22O/c1-4-5-6-7-17(3)18-10-14-20(15-11-18)21-19-12-8-16(2)9-13-19/h5-15H,4H2,1-3H3/b6-5-,17-7+ |
| InChIKey | JUQZSYGYKQWIBI-IANWOCAHSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|