C10H15FO — CID 143443539
ethane;1-(4-fluorocyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 143443539) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is ethane;1-(4-fluorocyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | ethane;1-(4-fluorocyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 143443539 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;1-(4-fluorocyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CC.CC(=O)C1=CC=C(F)CC1 |
| InChI | InChI=1S/C8H9FO.C2H6/c1-6(10)7-2-4-8(9)5-3-7;1-2/h2,4H,3,5H2,1H3;1-2H3 |
| InChIKey | LBQPNEYOPICAAQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |