C20H6F10O4 — CID 11113846
bis(2,3,4,5,6-pentafluorophenyl) cyclohexa-1,3-diene-1,4-dicarboxylate (PubChem CID 11113846) has the molecular formula C20H6F10O4 and a molecular weight of 500.24 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) cyclohexa-1,3-diene-1,4-dicarboxylate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) cyclohexa-1,3-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11113846 |
| Molecular Formula | C20H6F10O4 |
| Molecular Weight | 500.24 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) cyclohexa-1,3-diene-1,4-dicarboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)C1=CC=C(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H6F10O4/c21-7-9(23)13(27)17(14(28)10(7)24)33-19(31)5-1-2-6(4-3-5)20(32)34-18-15(29)11(25)8(22)12(26)16(18)30/h1-2H,3-4H2 |
| InChIKey | OZMDDANLSRHYCK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.24 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|