C13H16SiZr — CID 173300628
di(cyclopenta-1,3-dien-1-yl)methylidene-dimethylsilylidenezirconium (PubChem CID 173300628) has the molecular formula C13H16SiZr and a molecular weight of 291.58 g/mol. Its IUPAC name is di(cyclopenta-1,3-dien-1-yl)methylidene-dimethylsilylidenezirconium.
| Compound Name | di(cyclopenta-1,3-dien-1-yl)methylidene-dimethylsilylidenezirconium |
|---|---|
| PubChem CID | 173300628 |
| Molecular Formula | C13H16SiZr |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | di(cyclopenta-1,3-dien-1-yl)methylidene-dimethylsilylidenezirconium |
| SMILES | C[Si](C)=[Zr]=C(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C11H10.C2H6Si.Zr/c1-2-6-10(5-1)9-11-7-3-4-8-11;1-3-2;/h1-5,7H,6,8H2;1-2H3; |
| InChIKey | GYPXYHFFJWTCQS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|