C11H10NO- — CID 59861932
N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene-1-carboximidate (PubChem CID 59861932) has the molecular formula C11H10NO- and a molecular weight of 172.21 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene-1-carboximidate.
| Compound Name | N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene-1-carboximidate |
|---|---|
| PubChem CID | 59861932 |
| Molecular Formula | C11H10NO- |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene-1-carboximidate |
| SMILES | [O-]/C(=N\C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C11H11NO/c13-11(9-5-1-2-6-9)12-10-7-3-4-8-10/h1-5,7H,6,8H2,(H,12,13)/p-1 |
| InChIKey | BFGIRFLOTYLRRX-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|