C20H14NO- — CID 59861888
N-cyclopenta-1,3-dien-1-ylanthracene-9-carboximidate (PubChem CID 59861888) has the molecular formula C20H14NO- and a molecular weight of 284.34 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-ylanthracene-9-carboximidate.
| Compound Name | N-cyclopenta-1,3-dien-1-ylanthracene-9-carboximidate |
|---|---|
| PubChem CID | 59861888 |
| Molecular Formula | C20H14NO- |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-ylanthracene-9-carboximidate |
| SMILES | [O-]/C(=N\C1=CC=CC1)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C20H15NO/c22-20(21-16-9-3-4-10-16)19-17-11-5-1-7-14(17)13-15-8-2-6-12-18(15)19/h1-9,11-13H,10H2,(H,21,22)/p-1 |
| InChIKey | VXTWIILARSHGGB-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|