C11H10N2O — CID 136913192
4-(cyclopenta-1,3-dien-1-yldiazenyl)phenol (PubChem CID 136913192) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-(cyclopenta-1,3-dien-1-yldiazenyl)phenol.
| Compound Name | 4-(cyclopenta-1,3-dien-1-yldiazenyl)phenol |
|---|---|
| PubChem CID | 136913192 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-(cyclopenta-1,3-dien-1-yldiazenyl)phenol |
| SMILES | Oc1ccc(/N=N/C2=CC=CC2)cc1 |
| InChI | InChI=1S/C11H10N2O/c14-11-7-5-10(6-8-11)13-12-9-3-1-2-4-9/h1-3,5-8,14H,4H2/b13-12+ |
| InChIKey | XZWRDVUZEJYJLD-OUKQBFOZSA-N |
| XLogP | 3.32 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|