C19H15NNiO2 — CID 42634362
N-(2,4-dimethylphenyl)-2-oxidonaphthalene-1-carboximidate;nickel(2+) (PubChem CID 42634362) has the molecular formula C19H15NNiO2 and a molecular weight of 348.03 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-oxidonaphthalene-1-carboximidate;nickel(2+).
| Compound Name | N-(2,4-dimethylphenyl)-2-oxidonaphthalene-1-carboximidate;nickel(2+) |
|---|---|
| PubChem CID | 42634362 |
| Molecular Formula | C19H15NNiO2 |
| Molecular Weight | 348.03 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-oxidonaphthalene-1-carboximidate;nickel(2+) |
| SMILES | Cc1ccc(/N=C(\[O-])c2c([O-])ccc3ccccc23)c(C)c1.[Ni+2] |
| InChI | InChI=1S/C19H17NO2.Ni/c1-12-7-9-16(13(2)11-12)20-19(22)18-15-6-4-3-5-14(15)8-10-17(18)21;/h3-11,21H,1-2H3,(H,20,22);/q;+2/p-2 |
| InChIKey | BFCQWPOFSHFDTF-UHFFFAOYSA-L |
| XLogP | 2.97 |
| TPSA | 58.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.03 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|