C13H12Cl2HgN — CID 101246102
N-(4-chlorophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine;mercury(1+);chloride (PubChem CID 101246102) has the molecular formula C13H12Cl2HgN and a molecular weight of 453.74 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine;mercury(1+);chloride.
| Compound Name | N-(4-chlorophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine;mercury(1+);chloride |
|---|---|
| PubChem CID | 101246102 |
| Molecular Formula | C13H12Cl2HgN |
| Molecular Weight | 453.74 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | N-(4-chlorophenyl)-1-cyclopenta-1,3-dien-1-ylethanimine;mercury(1+);chloride |
| SMILES | C/C(=N\c1ccc(Cl)cc1)C1=CC=CC1.[Cl-].[Hg+] |
| InChI | InChI=1S/C13H12ClN.ClH.Hg/c1-10(11-4-2-3-5-11)15-13-8-6-12(14)7-9-13;;/h2-4,6-9H,5H2,1H3;1H;/q;;+1/p-1/b15-10+;; |
| InChIKey | VRMGICUQYTVMIJ-OVWKBUNZSA-M |
| XLogP | 1.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.74 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|