C17H23NO — CID 142137417
(3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide (PubChem CID 142137417) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide.
| Compound Name | (3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide |
|---|---|
| PubChem CID | 142137417 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (3Z,5E)-N-methyl-5-(4-methylcyclohepta-1,3,6-trien-1-yl)octa-3,5-dienamide |
| SMILES | CC/C=C(\C=C/CC(=O)NC)C1=CC=C(C)CC=C1 |
| InChI | InChI=1S/C17H23NO/c1-4-7-15(10-6-11-17(19)18-3)16-9-5-8-14(2)12-13-16/h5-7,9-10,12-13H,4,8,11H2,1-3H3,(H,18,19)/b10-6-,15-7+ |
| InChIKey | VGNXFGBHLKCHRC-GLAPMDOXSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|