C11H18N2O2 — CID 66935418
tert-butyl 1,5-diaminocyclohexa-2,4-diene-1-carboxylate (PubChem CID 66935418) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is tert-butyl 1,5-diaminocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | tert-butyl 1,5-diaminocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 66935418 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | tert-butyl 1,5-diaminocyclohexa-2,4-diene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(N)C=CC=C(N)C1 |
| InChI | InChI=1S/C11H18N2O2/c1-10(2,3)15-9(14)11(13)6-4-5-8(12)7-11/h4-6H,7,12-13H2,1-3H3 |
| InChIKey | OWVJWDMAALDYGZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |