C10H15IN2O2 — CID 151228239
tert-butyl 2-amino-4-iodo-3H-pyridine-4-carboxylate (PubChem CID 151228239) has the molecular formula C10H15IN2O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is tert-butyl 2-amino-4-iodo-3H-pyridine-4-carboxylate.
| Compound Name | tert-butyl 2-amino-4-iodo-3H-pyridine-4-carboxylate |
|---|---|
| PubChem CID | 151228239 |
| Molecular Formula | C10H15IN2O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | tert-butyl 2-amino-4-iodo-3H-pyridine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(I)C=CN=C(N)C1 |
| InChI | InChI=1S/C10H15IN2O2/c1-9(2,3)15-8(14)10(11)4-5-13-7(12)6-10/h4-5H,6H2,1-3H3,(H2,12,13) |
| InChIKey | NNSIVJYFZIEMLN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|