C16H20N2O2 — CID 143492527
tert-butyl 4-amino-12-azatetracyclo[6.3.1.02,7.010,12]dodeca-2(7),3,5-triene-10-carboxylate (PubChem CID 143492527) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is tert-butyl 4-amino-12-azatetracyclo[6.3.1.02,7.010,12]dodeca-2(7),3,5-triene-10-carboxylate.
| Compound Name | tert-butyl 4-amino-12-azatetracyclo[6.3.1.02,7.010,12]dodeca-2(7),3,5-triene-10-carboxylate |
|---|---|
| PubChem CID | 143492527 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | tert-butyl 4-amino-12-azatetracyclo[6.3.1.02,7.010,12]dodeca-2(7),3,5-triene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CC3c4ccc(N)cc4C(C1)N32 |
| InChI | InChI=1S/C16H20N2O2/c1-15(2,3)20-14(19)16-7-12-10-5-4-9(17)6-11(10)13(8-16)18(12)16/h4-6,12-13H,7-8,17H2,1-3H3 |
| InChIKey | ZEIJRRCKVYNFIS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|