C17H24N2O3 — CID 156632833
tert-butyl 6-aminospiro[2H-indole-3,4'-oxane]-1-carboxylate (PubChem CID 156632833) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 6-aminospiro[2H-indole-3,4'-oxane]-1-carboxylate.
| Compound Name | tert-butyl 6-aminospiro[2H-indole-3,4'-oxane]-1-carboxylate |
|---|---|
| PubChem CID | 156632833 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 6-aminospiro[2H-indole-3,4'-oxane]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCOCC2)c2ccc(N)cc21 |
| InChI | InChI=1S/C17H24N2O3/c1-16(2,3)22-15(20)19-11-17(6-8-21-9-7-17)13-5-4-12(18)10-14(13)19/h4-5,10H,6-9,11,18H2,1-3H3 |
| InChIKey | DFOYXVAGADRBBJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|