C20H23NO4 — CID 169332941
tert-butyl 6-(5-formylfuran-2-yl)-3,3-dimethyl-2H-indole-1-carboxylate (PubChem CID 169332941) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is tert-butyl 6-(5-formylfuran-2-yl)-3,3-dimethyl-2H-indole-1-carboxylate.
| Compound Name | tert-butyl 6-(5-formylfuran-2-yl)-3,3-dimethyl-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 169332941 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl 6-(5-formylfuran-2-yl)-3,3-dimethyl-2H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)c2ccc(-c3ccc(C=O)o3)cc21 |
| InChI | InChI=1S/C20H23NO4/c1-19(2,3)25-18(23)21-12-20(4,5)15-8-6-13(10-16(15)21)17-9-7-14(11-22)24-17/h6-11H,12H2,1-5H3 |
| InChIKey | UKCOSRLNJHFHGX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|