C23H21NO4 — CID 169334623
tert-butyl 2-[3-(5-formylfuran-2-yl)carbazol-9-yl]acetate (PubChem CID 169334623) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is tert-butyl 2-[3-(5-formylfuran-2-yl)carbazol-9-yl]acetate.
| Compound Name | tert-butyl 2-[3-(5-formylfuran-2-yl)carbazol-9-yl]acetate |
|---|---|
| PubChem CID | 169334623 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | tert-butyl 2-[3-(5-formylfuran-2-yl)carbazol-9-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c2ccccc2c2cc(-c3ccc(C=O)o3)ccc21 |
| InChI | InChI=1S/C23H21NO4/c1-23(2,3)28-22(26)13-24-19-7-5-4-6-17(19)18-12-15(8-10-20(18)24)21-11-9-16(14-25)27-21/h4-12,14H,13H2,1-3H3 |
| InChIKey | ZITCCBVDBXTWQN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|