C23H31NO6 — CID 175879484
3-[1,2-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid (PubChem CID 175879484) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 3-[1,2-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid.
| Compound Name | 3-[1,2-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 175879484 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 3-[1,2-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)Cc1c(CCC(=O)O)c2ccccc2n1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31NO6/c1-22(2,3)29-20(27)13-18-16(11-12-19(25)26)15-9-7-8-10-17(15)24(18)14-21(28)30-23(4,5)6/h7-10H,11-14H2,1-6H3,(H,25,26) |
| InChIKey | HDHMPSPUGCBWKI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|