About tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate
tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate (PubChem CID 168582163) has the molecular formula C22H22ClN3O2S
and a molecular weight of 427.96 g/mol. Its IUPAC name is tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate |
| PubChem CID | 168582163 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c2ccccc2c2cc(NCc3cnc(Cl)s3)ccc21 |
| InChI | InChI=1S/C22H22ClN3O2S/c1-22(2,3)28-20(27)13-26-18-7-5-4-6-16(18)17-10-14(8-9-19(17)26)24-11-15-12-25-21(23)29-15/h4-10,12,24H,11,13H2,1-3H3 |
| InChIKey | WLSLBBQSLIQIEN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate?
The IUPAC name of tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate (CID 168582163) is tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate.
What is the SMILES notation for tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate?
The canonical SMILES for tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate is CC(C)(C)OC(=O)Cn1c2ccccc2c2cc(NCc3cnc(Cl)s3)ccc21.
What is the InChIKey of tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate?
The InChIKey is WLSLBBQSLIQIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN3O2S/c1-22(2,3)28-20(27)13-26-18-7-5-4-6-16(18)17-10-14(8-9-19(17)26)24-11-15-12-25-21(23)29-15/h4-10,12,24H,11,13H2,1-3H3.
What are the key properties of tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate?
tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate has a molecular weight of 427.96 g/mol, XLogP of 5.86, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[3-[(2-chloro-1,3-thiazol-5-yl)methylamino]carbazol-9-yl]acetate is sourced from PubChem (CID 168582163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).