About 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol
2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol (PubChem CID 168582471) has the molecular formula C19H17ClN4OS
and a molecular weight of 384.89 g/mol. Its IUPAC name is 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol |
| PubChem CID | 168582471 |
| Molecular Formula | C19H17ClN4OS |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol |
| SMILES | OCCn1c(-c2ccccc2)nc2cc(NCc3cnc(Cl)s3)ccc21 |
| InChI | InChI=1S/C19H17ClN4OS/c20-19-22-12-15(26-19)11-21-14-6-7-17-16(10-14)23-18(24(17)8-9-25)13-4-2-1-3-5-13/h1-7,10,12,21,25H,8-9,11H2 |
| InChIKey | MWCSLDSAMLXXCO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol?
The IUPAC name of 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol (CID 168582471) is 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol?
The canonical SMILES for 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol is OCCn1c(-c2ccccc2)nc2cc(NCc3cnc(Cl)s3)ccc21.
What is the InChIKey of 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol?
The InChIKey is MWCSLDSAMLXXCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN4OS/c20-19-22-12-15(26-19)11-21-14-6-7-17-16(10-14)23-18(24(17)8-9-25)13-4-2-1-3-5-13/h1-7,10,12,21,25H,8-9,11H2.
What are the key properties of 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol?
2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol has a molecular weight of 384.89 g/mol, XLogP of 4.42, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(2-chloro-1,3-thiazol-5-yl)methylamino]-2-phenylbenzimidazol-1-yl]ethanol is sourced from PubChem (CID 168582471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).