C17H11ClIN3OS — CID 168583468
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(3-iodophenyl)-1,3-benzoxazol-5-amine (PubChem CID 168583468) has the molecular formula C17H11ClIN3OS and a molecular weight of 467.72 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(3-iodophenyl)-1,3-benzoxazol-5-amine.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(3-iodophenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 168583468 |
| Molecular Formula | C17H11ClIN3OS |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(3-iodophenyl)-1,3-benzoxazol-5-amine |
| SMILES | Clc1ncc(CNc2ccc3oc(-c4cccc(I)c4)nc3c2)s1 |
| InChI | InChI=1S/C17H11ClIN3OS/c18-17-21-9-13(24-17)8-20-12-4-5-15-14(7-12)22-16(23-15)10-2-1-3-11(19)6-10/h1-7,9,20H,8H2 |
| InChIKey | MJUVNHBLXLUOQQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|